C19H13Cl3N2O — CID 149334997
5-chloro-4-[[[2-(2,6-dichlorophenyl)phenyl]methylideneamino]methyl]pyridin-3-ol (PubChem CID 149334997) has the molecular formula C19H13Cl3N2O and a molecular weight of 391.69 g/mol. Its IUPAC name is 5-chloro-4-[[[2-(2,6-dichlorophenyl)phenyl]methylideneamino]methyl]pyridin-3-ol.
| Compound Name | 5-chloro-4-[[[2-(2,6-dichlorophenyl)phenyl]methylideneamino]methyl]pyridin-3-ol |
|---|---|
| PubChem CID | 149334997 |
| Molecular Formula | C19H13Cl3N2O |
| Molecular Weight | 391.69 g/mol |
| Exact Mass | 390.01 |
| IUPAC Name | 5-chloro-4-[[[2-(2,6-dichlorophenyl)phenyl]methylideneamino]methyl]pyridin-3-ol |
| SMILES | Oc1cncc(Cl)c1C/N=C/c1ccccc1-c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C19H13Cl3N2O/c20-15-6-3-7-16(21)19(15)13-5-2-1-4-12(13)8-23-9-14-17(22)10-24-11-18(14)25/h1-8,10-11,25H,9H2/b23-8+ |
| InChIKey | YDBIMTOIXZFOMR-LIMNOBDPSA-N |
| XLogP | 6.03 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.69 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|