C26H37NO2 — CID 14934532
(3S,5R,6S)-3-(dibenzylamino)-6-hydroxy-2,5,7,7-tetramethyloctan-4-one (PubChem CID 14934532) has the molecular formula C26H37NO2 and a molecular weight of 395.59 g/mol. Its IUPAC name is (3S,5R,6S)-3-(dibenzylamino)-6-hydroxy-2,5,7,7-tetramethyloctan-4-one.
| Compound Name | (3S,5R,6S)-3-(dibenzylamino)-6-hydroxy-2,5,7,7-tetramethyloctan-4-one |
|---|---|
| PubChem CID | 14934532 |
| Molecular Formula | C26H37NO2 |
| Molecular Weight | 395.59 g/mol |
| Exact Mass | 395.28 |
| IUPAC Name | (3S,5R,6S)-3-(dibenzylamino)-6-hydroxy-2,5,7,7-tetramethyloctan-4-one |
| SMILES | CC(C)[C@@H](C(=O)[C@H](C)[C@H](O)C(C)(C)C)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C26H37NO2/c1-19(2)23(24(28)20(3)25(29)26(4,5)6)27(17-21-13-9-7-10-14-21)18-22-15-11-8-12-16-22/h7-16,19-20,23,25,29H,17-18H2,1-6H3/t20-,23-,25-/m0/s1 |
| InChIKey | HUDLKKJLQITWAA-OPHFCASCSA-N |
| XLogP | 5.33 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.59 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |