C20H20FN3O4 — CID 149357737
4-[3-[(8aS)-3-oxo-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyrazin-2-yl]-5-fluorophenoxy]-3-methylbenzoic acid (PubChem CID 149357737) has the molecular formula C20H20FN3O4 and a molecular weight of 385.40 g/mol. Its IUPAC name is 4-[3-[(8aS)-3-oxo-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyrazin-2-yl]-5-fluorophenoxy]-3-methylbenzoic acid.
| Compound Name | 4-[3-[(8aS)-3-oxo-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyrazin-2-yl]-5-fluorophenoxy]-3-methylbenzoic acid |
|---|---|
| PubChem CID | 149357737 |
| Molecular Formula | C20H20FN3O4 |
| Molecular Weight | 385.40 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | 4-[3-[(8aS)-3-oxo-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyrazin-2-yl]-5-fluorophenoxy]-3-methylbenzoic acid |
| SMILES | Cc1cc(C(=O)O)ccc1Oc1cc(F)cc(N2C[C@@H]3CNCCN3C2=O)c1 |
| InChI | InChI=1S/C20H20FN3O4/c1-12-6-13(19(25)26)2-3-18(12)28-17-8-14(21)7-15(9-17)24-11-16-10-22-4-5-23(16)20(24)27/h2-3,6-9,16,22H,4-5,10-11H2,1H3,(H,25,26)/t16-/m0/s1 |
| InChIKey | YHHFVLMBYKKWIV-INIZCTEOSA-N |
| XLogP | 2.84 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.40 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |