C25H28O6 — CID 14936255
2-O-ethyl 3-O,4-O-dimethyl 1,5,7,9-tetramethyl-1,2-dihydrobenzo[a]azulene-2,3,4-tricarboxylate (PubChem CID 14936255) has the molecular formula C25H28O6 and a molecular weight of 424.49 g/mol. Its IUPAC name is 2-O-ethyl 3-O,4-O-dimethyl 1,5,7,9-tetramethyl-1,2-dihydrobenzo[a]azulene-2,3,4-tricarboxylate.
| Compound Name | 2-O-ethyl 3-O,4-O-dimethyl 1,5,7,9-tetramethyl-1,2-dihydrobenzo[a]azulene-2,3,4-tricarboxylate |
|---|---|
| PubChem CID | 14936255 |
| Molecular Formula | C25H28O6 |
| Molecular Weight | 424.49 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | 2-O-ethyl 3-O,4-O-dimethyl 1,5,7,9-tetramethyl-1,2-dihydrobenzo[a]azulene-2,3,4-tricarboxylate |
| SMILES | CCOC(=O)C1C(C(=O)OC)=C(C(=O)OC)c2c(cc3c(C)cc(C)cc(C)c2-3)C1C |
| InChI | InChI=1S/C25H28O6/c1-8-31-25(28)19-15(5)17-11-16-13(3)9-12(2)10-14(4)18(16)20(17)22(24(27)30-7)21(19)23(26)29-6/h9-11,15,19H,8H2,1-7H3 |
| InChIKey | YFPLFRMKEZSODD-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.49 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|