C25H30O16 — CID 4200594
1-O,1-O'-diethyl 2-O,3-O,4-O,5-O,6-O,7-O-hexamethyl cyclohepta-3,5-diene-1,1,2,3,4,5,6,7-octacarboxylate (PubChem CID 4200594) has the molecular formula C25H30O16 and a molecular weight of 586.50 g/mol. Its IUPAC name is 1-O,1-O'-diethyl 2-O,3-O,4-O,5-O,6-O,7-O-hexamethyl cyclohepta-3,5-diene-1,1,2,3,4,5,6,7-octacarboxylate.
| Compound Name | 1-O,1-O'-diethyl 2-O,3-O,4-O,5-O,6-O,7-O-hexamethyl cyclohepta-3,5-diene-1,1,2,3,4,5,6,7-octacarboxylate |
|---|---|
| PubChem CID | 4200594 |
| Molecular Formula | C25H30O16 |
| Molecular Weight | 586.50 g/mol |
| Exact Mass | 586.15 |
| IUPAC Name | 1-O,1-O'-diethyl 2-O,3-O,4-O,5-O,6-O,7-O-hexamethyl cyclohepta-3,5-diene-1,1,2,3,4,5,6,7-octacarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)C(C(=O)OC)C(C(=O)OC)=C(C(=O)OC)C(C(=O)OC)=C(C(=O)OC)C1C(=O)OC |
| InChI | InChI=1S/C25H30O16/c1-9-40-23(32)25(24(33)41-10-2)15(21(30)38-7)13(19(28)36-5)11(17(26)34-3)12(18(27)35-4)14(20(29)37-6)16(25)22(31)39-8/h15-16H,9-10H2,1-8H3 |
| InChIKey | BRQPSKTURMIRNZ-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 210.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.50 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|