C26H45NO3SSn — CID 14936724
2-[(3R,4R)-1-(4-methylphenyl)sulfonyl-4-(tributylstannylmethyl)pyrrolidin-3-yl]acetaldehyde (PubChem CID 14936724) has the molecular formula C26H45NO3SSn and a molecular weight of 570.43 g/mol. Its IUPAC name is 2-[(3R,4R)-1-(4-methylphenyl)sulfonyl-4-(tributylstannylmethyl)pyrrolidin-3-yl]acetaldehyde.
| Compound Name | 2-[(3R,4R)-1-(4-methylphenyl)sulfonyl-4-(tributylstannylmethyl)pyrrolidin-3-yl]acetaldehyde |
|---|---|
| PubChem CID | 14936724 |
| Molecular Formula | C26H45NO3SSn |
| Molecular Weight | 570.43 g/mol |
| Exact Mass | 571.21 |
| IUPAC Name | 2-[(3R,4R)-1-(4-methylphenyl)sulfonyl-4-(tributylstannylmethyl)pyrrolidin-3-yl]acetaldehyde |
| SMILES | CCCC[Sn](CCCC)(CCCC)C[C@H]1CN(S(=O)(=O)c2ccc(C)cc2)C[C@@H]1CC=O |
| InChI | InChI=1S/C14H18NO3S.3C4H9.Sn/c1-11-3-5-14(6-4-11)19(17,18)15-9-12(2)13(10-15)7-8-16;3*1-3-4-2;/h3-6,8,12-13H,2,7,9-10H2,1H3;3*1,3-4H2,2H3;/t12-,13-;;;;/m0..../s1 |
| InChIKey | FSRRRFUHWBYXMH-FDUIRRPTSA-N |
| XLogP | 6.67 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.43 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|