C18H18ClNO4S — CID 54294285
2-[(3S,4R)-1-(4-chlorophenyl)sulfonyl-4-(2-hydroxyphenyl)pyrrolidin-3-yl]acetaldehyde (PubChem CID 54294285) has the molecular formula C18H18ClNO4S and a molecular weight of 379.87 g/mol. Its IUPAC name is 2-[(3S,4R)-1-(4-chlorophenyl)sulfonyl-4-(2-hydroxyphenyl)pyrrolidin-3-yl]acetaldehyde.
| Compound Name | 2-[(3S,4R)-1-(4-chlorophenyl)sulfonyl-4-(2-hydroxyphenyl)pyrrolidin-3-yl]acetaldehyde |
|---|---|
| PubChem CID | 54294285 |
| Molecular Formula | C18H18ClNO4S |
| Molecular Weight | 379.87 g/mol |
| Exact Mass | 379.06 |
| IUPAC Name | 2-[(3S,4R)-1-(4-chlorophenyl)sulfonyl-4-(2-hydroxyphenyl)pyrrolidin-3-yl]acetaldehyde |
| SMILES | O=CC[C@@H]1CN(S(=O)(=O)c2ccc(Cl)cc2)C[C@H]1c1ccccc1O |
| InChI | InChI=1S/C18H18ClNO4S/c19-14-5-7-15(8-6-14)25(23,24)20-11-13(9-10-21)17(12-20)16-3-1-2-4-18(16)22/h1-8,10,13,17,22H,9,11-12H2/t13-,17-/m1/s1 |
| InChIKey | RZRWPOXPASELIR-CXAGYDPISA-N |
| XLogP | 3.04 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.87 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|