C25H26N2O5S — CID 54069502
6-[(3R,4R)-4-(2-hydroxyphenyl)-1-quinolin-8-ylsulfonylpyrrolidin-3-yl]hex-4-enoic acid (PubChem CID 54069502) has the molecular formula C25H26N2O5S and a molecular weight of 466.56 g/mol. Its IUPAC name is 6-[(3R,4R)-4-(2-hydroxyphenyl)-1-quinolin-8-ylsulfonylpyrrolidin-3-yl]hex-4-enoic acid.
| Compound Name | 6-[(3R,4R)-4-(2-hydroxyphenyl)-1-quinolin-8-ylsulfonylpyrrolidin-3-yl]hex-4-enoic acid |
|---|---|
| PubChem CID | 54069502 |
| Molecular Formula | C25H26N2O5S |
| Molecular Weight | 466.56 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | 6-[(3R,4R)-4-(2-hydroxyphenyl)-1-quinolin-8-ylsulfonylpyrrolidin-3-yl]hex-4-enoic acid |
| SMILES | O=C(O)CCC=CC[C@H]1CN(S(=O)(=O)c2cccc3cccnc23)C[C@H]1c1ccccc1O |
| InChI | InChI=1S/C25H26N2O5S/c28-22-12-5-4-11-20(22)21-17-27(16-19(21)8-2-1-3-14-24(29)30)33(31,32)23-13-6-9-18-10-7-15-26-25(18)23/h1-2,4-7,9-13,15,19,21,28H,3,8,14,16-17H2,(H,29,30)/t19-,21+/m0/s1 |
| InChIKey | MFJWRXPHFPPWDJ-PZJWPPBQSA-N |
| XLogP | 4.16 |
| TPSA | 107.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.56 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|