C36H43N2O7S+ — CID 149367491
1-but-3-enyl-2-[5-[1-[2-(1,3-dioxolan-2-yl)ethyl]-5-methoxycarbonyl-3,3-dimethylindol-2-ylidene]penta-1,3-dienyl]-3,3-dimethylindol-1-ium-5-sulfonic acid (PubChem CID 149367491) has the molecular formula C36H43N2O7S+ and a molecular weight of 647.81 g/mol. Its IUPAC name is 1-but-3-enyl-2-[5-[1-[2-(1,3-dioxolan-2-yl)ethyl]-5-methoxycarbonyl-3,3-dimethylindol-2-ylidene]penta-1,3-dienyl]-3,3-dimethylindol-1-ium-5-sulfonic acid.
| Compound Name | 1-but-3-enyl-2-[5-[1-[2-(1,3-dioxolan-2-yl)ethyl]-5-methoxycarbonyl-3,3-dimethylindol-2-ylidene]penta-1,3-dienyl]-3,3-dimethylindol-1-ium-5-sulfonic acid |
|---|---|
| PubChem CID | 149367491 |
| Molecular Formula | C36H43N2O7S+ |
| Molecular Weight | 647.81 g/mol |
| Exact Mass | 647.28 |
| IUPAC Name | 1-but-3-enyl-2-[5-[1-[2-(1,3-dioxolan-2-yl)ethyl]-5-methoxycarbonyl-3,3-dimethylindol-2-ylidene]penta-1,3-dienyl]-3,3-dimethylindol-1-ium-5-sulfonic acid |
| SMILES | C=CCC[N+]1=C(C=CC=CC=C2N(CCC3OCCO3)c3ccc(C(=O)OC)cc3C2(C)C)C(C)(C)c2cc(S(=O)(=O)O)ccc21 |
| InChI | InChI=1S/C36H42N2O7S/c1-7-8-19-37-30-17-15-26(46(40,41)42)24-28(30)36(4,5)31(37)12-10-9-11-13-32-35(2,3)27-23-25(34(39)43-6)14-16-29(27)38(32)20-18-33-44-21-22-45-33/h7,9-17,23-24,33H,1,8,18-22H2,2-6H3/p+1 |
| InChIKey | HDHXTZJWYMNKGJ-UHFFFAOYSA-O |
| XLogP | 6.23 |
| TPSA | 105.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.81 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|