C24H27N3O4S — CID 1493716
4-[(2R)-2-(1,3-benzodioxol-5-yl)-4-oxoazetidin-1-yl]-N-[4-(dimethylamino)phenyl]thiane-4-carboxamide (PubChem CID 1493716) has the molecular formula C24H27N3O4S and a molecular weight of 453.56 g/mol. Its IUPAC name is 4-[(2R)-2-(1,3-benzodioxol-5-yl)-4-oxoazetidin-1-yl]-N-[4-(dimethylamino)phenyl]thiane-4-carboxamide.
| Compound Name | 4-[(2R)-2-(1,3-benzodioxol-5-yl)-4-oxoazetidin-1-yl]-N-[4-(dimethylamino)phenyl]thiane-4-carboxamide |
|---|---|
| PubChem CID | 1493716 |
| Molecular Formula | C24H27N3O4S |
| Molecular Weight | 453.56 g/mol |
| Exact Mass | 453.17 |
| IUPAC Name | 4-[(2R)-2-(1,3-benzodioxol-5-yl)-4-oxoazetidin-1-yl]-N-[4-(dimethylamino)phenyl]thiane-4-carboxamide |
| SMILES | CN(C)c1ccc(NC(=O)C2(N3C(=O)C[C@@H]3c3ccc4c(c3)OCO4)CCSCC2)cc1 |
| InChI | InChI=1S/C24H27N3O4S/c1-26(2)18-6-4-17(5-7-18)25-23(29)24(9-11-32-12-10-24)27-19(14-22(27)28)16-3-8-20-21(13-16)31-15-30-20/h3-8,13,19H,9-12,14-15H2,1-2H3,(H,25,29)/t19-/m1/s1 |
| InChIKey | SOSHFZIMOFMMLW-LJQANCHMSA-N |
| XLogP | 3.66 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.56 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|