C21H21N5O3S2 — CID 149413902
2-(2-amino-1,3-benzothiazol-6-yl)-N-[5-[2-(ethoxymethoxy)-4-methylphenyl]-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 149413902) has the molecular formula C21H21N5O3S2 and a molecular weight of 455.57 g/mol. Its IUPAC name is 2-(2-amino-1,3-benzothiazol-6-yl)-N-[5-[2-(ethoxymethoxy)-4-methylphenyl]-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | 2-(2-amino-1,3-benzothiazol-6-yl)-N-[5-[2-(ethoxymethoxy)-4-methylphenyl]-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 149413902 |
| Molecular Formula | C21H21N5O3S2 |
| Molecular Weight | 455.57 g/mol |
| Exact Mass | 455.11 |
| IUPAC Name | 2-(2-amino-1,3-benzothiazol-6-yl)-N-[5-[2-(ethoxymethoxy)-4-methylphenyl]-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | CCOCOc1cc(C)ccc1-c1nnc(NC(=O)Cc2ccc3nc(N)sc3c2)s1 |
| InChI | InChI=1S/C21H21N5O3S2/c1-3-28-11-29-16-8-12(2)4-6-14(16)19-25-26-21(31-19)24-18(27)10-13-5-7-15-17(9-13)30-20(22)23-15/h4-9H,3,10-11H2,1-2H3,(H2,22,23)(H,24,26,27) |
| InChIKey | YRULKMIRNIZJKU-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 112.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.57 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|