C33H29NO9 — CID 149419557
[(2R,5S)-3,4-dibenzoyloxy-5-(5-ethyl-2,6-dioxo-3H-pyridin-3-yl)oxolan-2-yl]methyl benzoate (PubChem CID 149419557) has the molecular formula C33H29NO9 and a molecular weight of 583.59 g/mol. Its IUPAC name is [(2R,5S)-3,4-dibenzoyloxy-5-(5-ethyl-2,6-dioxo-3H-pyridin-3-yl)oxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,5S)-3,4-dibenzoyloxy-5-(5-ethyl-2,6-dioxo-3H-pyridin-3-yl)oxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 149419557 |
| Molecular Formula | C33H29NO9 |
| Molecular Weight | 583.59 g/mol |
| Exact Mass | 583.18 |
| IUPAC Name | [(2R,5S)-3,4-dibenzoyloxy-5-(5-ethyl-2,6-dioxo-3H-pyridin-3-yl)oxolan-2-yl]methyl benzoate |
| SMILES | CCC1=CC([C@@H]2O[C@H](COC(=O)c3ccccc3)C(OC(=O)c3ccccc3)C2OC(=O)c2ccccc2)C(=O)NC1=O |
| InChI | InChI=1S/C33H29NO9/c1-2-20-18-24(30(36)34-29(20)35)26-28(43-33(39)23-16-10-5-11-17-23)27(42-32(38)22-14-8-4-9-15-22)25(41-26)19-40-31(37)21-12-6-3-7-13-21/h3-18,24-28H,2,19H2,1H3,(H,34,35,36)/t24?,25-,26+,27?,28?/m1/s1 |
| InChIKey | YSWIADWDUHABKX-WNAPOJDSSA-N |
| XLogP | 3.67 |
| TPSA | 134.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.59 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|