C16H23N2O+ — CID 149427220
[1-(aminomethyl)-3-phenylmethoxycyclobutyl]methylidene-propylideneazanium (PubChem CID 149427220) has the molecular formula C16H23N2O+ and a molecular weight of 259.37 g/mol. Its IUPAC name is [1-(aminomethyl)-3-phenylmethoxycyclobutyl]methylidene-propylideneazanium.
| Compound Name | [1-(aminomethyl)-3-phenylmethoxycyclobutyl]methylidene-propylideneazanium |
|---|---|
| PubChem CID | 149427220 |
| Molecular Formula | C16H23N2O+ |
| Molecular Weight | 259.37 g/mol |
| Exact Mass | 259.18 |
| IUPAC Name | [1-(aminomethyl)-3-phenylmethoxycyclobutyl]methylidene-propylideneazanium |
| SMILES | CCC=[N+]=CC1(CN)CC(OCc2ccccc2)C1 |
| InChI | InChI=1S/C16H23N2O/c1-2-8-18-13-16(12-17)9-15(10-16)19-11-14-6-4-3-5-7-14/h3-8,13,15H,2,9-12,17H2,1H3/q+1 |
| InChIKey | VGBXSMAUYCKMKB-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 49.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.37 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|