C14H22ClNO — CID 10912129
1,1-diethyl-3-phenylmethoxyazetidin-1-ium chloride (PubChem CID 10912129) has the molecular formula C14H22ClNO and a molecular weight of 255.79 g/mol. Its IUPAC name is 1,1-diethyl-3-phenylmethoxyazetidin-1-ium chloride.
| Compound Name | 1,1-diethyl-3-phenylmethoxyazetidin-1-ium chloride |
|---|---|
| PubChem CID | 10912129 |
| Molecular Formula | C14H22ClNO |
| Molecular Weight | 255.79 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | 1,1-diethyl-3-phenylmethoxyazetidin-1-ium chloride |
| SMILES | CC[N+]1(CC)CC(OCc2ccccc2)C1.[Cl-] |
| InChI | InChI=1S/C14H22NO.ClH/c1-3-15(4-2)10-14(11-15)16-12-13-8-6-5-7-9-13;/h5-9,14H,3-4,10-12H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | LIQRYQTVPYVPKL-UHFFFAOYSA-M |
| XLogP | -0.55 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.79 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|