About CID 149433419
CID 149433419 (PubChem CID 149433419) has the molecular formula H2NO4S-
and a molecular weight of 112.09 g/mol.
Molecular Properties
| Compound Name | CID 149433419 |
| PubChem CID | 149433419 |
| Molecular Formula | H2NO4S- |
| Molecular Weight | 112.09 g/mol |
| Exact Mass | 111.97 |
| IUPAC Name | — |
| SMILES | O=S([O-])N(O)O |
| InChI | InChI=1S/H3NO4S/c2-1(3)6(4)5/h2-3H,(H,4,5)/p-1 |
| InChIKey | AKCPXONDHOCQRO-UHFFFAOYSA-M |
| XLogP | -1.14 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.09 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze CID 149433419 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 149433419?
The IUPAC name of CID 149433419 (CID 149433419) is not available.
What is the SMILES notation for CID 149433419?
The canonical SMILES for CID 149433419 is O=S([O-])N(O)O.
What is the InChIKey of CID 149433419?
The InChIKey is AKCPXONDHOCQRO-UHFFFAOYSA-M. The full InChI is InChI=1S/H3NO4S/c2-1(3)6(4)5/h2-3H,(H,4,5)/p-1.
What are the key properties of CID 149433419?
CID 149433419 has a molecular weight of 112.09 g/mol, XLogP of -1.14, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 149433419 is sourced from PubChem (CID 149433419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).