C13H30O6SSi — CID 149435492
1,4,4-tris(2-methoxyethoxy)-4-silylbutane-1-thiol (PubChem CID 149435492) has the molecular formula C13H30O6SSi and a molecular weight of 342.53 g/mol. Its IUPAC name is 1,4,4-tris(2-methoxyethoxy)-4-silylbutane-1-thiol.
| Compound Name | 1,4,4-tris(2-methoxyethoxy)-4-silylbutane-1-thiol |
|---|---|
| PubChem CID | 149435492 |
| Molecular Formula | C13H30O6SSi |
| Molecular Weight | 342.53 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | 1,4,4-tris(2-methoxyethoxy)-4-silylbutane-1-thiol |
| SMILES | COCCOC(S)CCC([SiH3])(OCCOC)OCCOC |
| InChI | InChI=1S/C13H30O6SSi/c1-14-6-9-17-12(20)4-5-13(21,18-10-7-15-2)19-11-8-16-3/h12,20H,4-11H2,1-3,21H3 |
| InChIKey | PUOXFRWBDQJWNM-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 55.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.53 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|