C8H21N3Si — CID 149435548
1-N,1-N',2-N-triethyl-2-silylethene-1,1,2-triamine (PubChem CID 149435548) has the molecular formula C8H21N3Si and a molecular weight of 187.36 g/mol. Its IUPAC name is 1-N,1-N',2-N-triethyl-2-silylethene-1,1,2-triamine.
| Compound Name | 1-N,1-N',2-N-triethyl-2-silylethene-1,1,2-triamine |
|---|---|
| PubChem CID | 149435548 |
| Molecular Formula | C8H21N3Si |
| Molecular Weight | 187.36 g/mol |
| Exact Mass | 187.15 |
| IUPAC Name | 1-N,1-N',2-N-triethyl-2-silylethene-1,1,2-triamine |
| SMILES | CCNC([SiH3])=C(NCC)NCC |
| InChI | InChI=1S/C8H21N3Si/c1-4-9-7(10-5-2)8(12)11-6-3/h9-11H,4-6H2,1-3,12H3 |
| InChIKey | RODZWYJNQGQKRY-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.36 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|