C25H32F3N5O2S — CID 149441706
(E)-N-[4-[2-[2-(2,2-difluoroethoxy)-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-yl]ethyl]-4-fluorocyclohexyl]-3-(2-methylpyrimidin-5-yl)prop-2-enamide (PubChem CID 149441706) has the molecular formula C25H32F3N5O2S and a molecular weight of 523.63 g/mol. Its IUPAC name is (E)-N-[4-[2-[2-(2,2-difluoroethoxy)-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-yl]ethyl]-4-fluorocyclohexyl]-3-(2-methylpyrimidin-5-yl)prop-2-enamide.
| Compound Name | (E)-N-[4-[2-[2-(2,2-difluoroethoxy)-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-yl]ethyl]-4-fluorocyclohexyl]-3-(2-methylpyrimidin-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 149441706 |
| Molecular Formula | C25H32F3N5O2S |
| Molecular Weight | 523.63 g/mol |
| Exact Mass | 523.22 |
| IUPAC Name | (E)-N-[4-[2-[2-(2,2-difluoroethoxy)-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-yl]ethyl]-4-fluorocyclohexyl]-3-(2-methylpyrimidin-5-yl)prop-2-enamide |
| SMILES | Cc1ncc(/C=C/C(=O)NC2CCC(F)(CCN3CCc4nc(OCC(F)F)sc4CC3)CC2)cn1 |
| InChI | InChI=1S/C25H32F3N5O2S/c1-17-29-14-18(15-30-17)2-3-23(34)31-19-4-8-25(28,9-5-19)10-13-33-11-6-20-21(7-12-33)36-24(32-20)35-16-22(26)27/h2-3,14-15,19,22H,4-13,16H2,1H3,(H,31,34)/b3-2+ |
| InChIKey | YVWRSMPIFCRHNU-NSCUHMNNSA-N |
| XLogP | 4.16 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.63 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|