C25H35NO2 — CID 14945382
(3S,6R)-3-(dibenzylamino)-6-hydroxy-2,7,7-trimethyloctan-4-one (PubChem CID 14945382) has the molecular formula C25H35NO2 and a molecular weight of 381.56 g/mol. Its IUPAC name is (3S,6R)-3-(dibenzylamino)-6-hydroxy-2,7,7-trimethyloctan-4-one.
| Compound Name | (3S,6R)-3-(dibenzylamino)-6-hydroxy-2,7,7-trimethyloctan-4-one |
|---|---|
| PubChem CID | 14945382 |
| Molecular Formula | C25H35NO2 |
| Molecular Weight | 381.56 g/mol |
| Exact Mass | 381.27 |
| IUPAC Name | (3S,6R)-3-(dibenzylamino)-6-hydroxy-2,7,7-trimethyloctan-4-one |
| SMILES | CC(C)[C@@H](C(=O)C[C@@H](O)C(C)(C)C)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C25H35NO2/c1-19(2)24(22(27)16-23(28)25(3,4)5)26(17-20-12-8-6-9-13-20)18-21-14-10-7-11-15-21/h6-15,19,23-24,28H,16-18H2,1-5H3/t23-,24+/m1/s1 |
| InChIKey | HKMQAIMYEGGSDS-RPWUZVMVSA-N |
| XLogP | 5.08 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.56 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |