C11H14N4O — CID 149454712
5-(6-butan-2-yl-3-pyridinyl)-1,2,4-oxadiazol-3-amine (PubChem CID 149454712) has the molecular formula C11H14N4O and a molecular weight of 218.26 g/mol. Its IUPAC name is 5-(6-butan-2-yl-3-pyridinyl)-1,2,4-oxadiazol-3-amine.
| Compound Name | 5-(6-butan-2-yl-3-pyridinyl)-1,2,4-oxadiazol-3-amine |
|---|---|
| PubChem CID | 149454712 |
| Molecular Formula | C11H14N4O |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | 5-(6-butan-2-yl-3-pyridinyl)-1,2,4-oxadiazol-3-amine |
| SMILES | CCC(C)c1ccc(-c2nc(N)no2)cn1 |
| InChI | InChI=1S/C11H14N4O/c1-3-7(2)9-5-4-8(6-13-9)10-14-11(12)15-16-10/h4-7H,3H2,1-2H3,(H2,12,15) |
| InChIKey | YYHYEHDXYDKMRD-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 77.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |