C16H23NOS — CID 149454922
2-tert-butyl-4-ethoxy-6-propan-2-yl-1,3-benzothiazole (PubChem CID 149454922) has the molecular formula C16H23NOS and a molecular weight of 277.43 g/mol. Its IUPAC name is 2-tert-butyl-4-ethoxy-6-propan-2-yl-1,3-benzothiazole.
| Compound Name | 2-tert-butyl-4-ethoxy-6-propan-2-yl-1,3-benzothiazole |
|---|---|
| PubChem CID | 149454922 |
| Molecular Formula | C16H23NOS |
| Molecular Weight | 277.43 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | 2-tert-butyl-4-ethoxy-6-propan-2-yl-1,3-benzothiazole |
| SMILES | CCOc1cc(C(C)C)cc2sc(C(C)(C)C)nc12 |
| InChI | InChI=1S/C16H23NOS/c1-7-18-12-8-11(10(2)3)9-13-14(12)17-15(19-13)16(4,5)6/h8-10H,7H2,1-6H3 |
| InChIKey | YYJBBZNPUFMDQZ-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.43 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |