About S-ethyl 3-ethylsulfanylpropanethioate
S-ethyl 3-ethylsulfanylpropanethioate (PubChem CID 14948084) has the molecular formula C7H14OS2
and a molecular weight of 178.32 g/mol. Its IUPAC name is S-ethyl 3-ethylsulfanylpropanethioate.
Molecular Properties
| Compound Name | S-ethyl 3-ethylsulfanylpropanethioate |
| PubChem CID | 14948084 |
| Molecular Formula | C7H14OS2 |
| Molecular Weight | 178.32 g/mol |
| Exact Mass | 178.05 |
| IUPAC Name | S-ethyl 3-ethylsulfanylpropanethioate |
| SMILES | CCSCCC(=O)SCC |
| InChI | InChI=1S/C7H14OS2/c1-3-9-6-5-7(8)10-4-2/h3-6H2,1-2H3 |
| InChIKey | JEHZUHNPBVBDKE-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.32 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-ethyl 3-ethylsulfanylpropanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-ethyl 3-ethylsulfanylpropanethioate?
The IUPAC name of S-ethyl 3-ethylsulfanylpropanethioate (CID 14948084) is S-ethyl 3-ethylsulfanylpropanethioate.
What is the SMILES notation for S-ethyl 3-ethylsulfanylpropanethioate?
The canonical SMILES for S-ethyl 3-ethylsulfanylpropanethioate is CCSCCC(=O)SCC.
What is the InChIKey of S-ethyl 3-ethylsulfanylpropanethioate?
The InChIKey is JEHZUHNPBVBDKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14OS2/c1-3-9-6-5-7(8)10-4-2/h3-6H2,1-2H3.
What are the key properties of S-ethyl 3-ethylsulfanylpropanethioate?
S-ethyl 3-ethylsulfanylpropanethioate has a molecular weight of 178.32 g/mol, XLogP of 2.41, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-ethyl 3-ethylsulfanylpropanethioate is sourced from PubChem (CID 14948084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).