About S-ethyl 16-oxohexadecanethioate
S-ethyl 16-oxohexadecanethioate (PubChem CID 102082817) has the molecular formula C18H34O2S
and a molecular weight of 314.54 g/mol. Its IUPAC name is S-ethyl 16-oxohexadecanethioate.
Molecular Properties
| Compound Name | S-ethyl 16-oxohexadecanethioate |
| PubChem CID | 102082817 |
| Molecular Formula | C18H34O2S |
| Molecular Weight | 314.54 g/mol |
| Exact Mass | 314.23 |
| IUPAC Name | S-ethyl 16-oxohexadecanethioate |
| SMILES | CCSC(=O)CCCCCCCCCCCCCCC=O |
| InChI | InChI=1S/C18H34O2S/c1-2-21-18(20)16-14-12-10-8-6-4-3-5-7-9-11-13-15-17-19/h17H,2-16H2,1H3 |
| InChIKey | WGYNPKRZQOOCGG-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 314.54 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-ethyl 16-oxohexadecanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-ethyl 16-oxohexadecanethioate?
The IUPAC name of S-ethyl 16-oxohexadecanethioate (CID 102082817) is S-ethyl 16-oxohexadecanethioate.
What is the SMILES notation for S-ethyl 16-oxohexadecanethioate?
The canonical SMILES for S-ethyl 16-oxohexadecanethioate is CCSC(=O)CCCCCCCCCCCCCCC=O.
What is the InChIKey of S-ethyl 16-oxohexadecanethioate?
The InChIKey is WGYNPKRZQOOCGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H34O2S/c1-2-21-18(20)16-14-12-10-8-6-4-3-5-7-9-11-13-15-17-19/h17H,2-16H2,1H3.
What are the key properties of S-ethyl 16-oxohexadecanethioate?
S-ethyl 16-oxohexadecanethioate has a molecular weight of 314.54 g/mol, XLogP of 5.93, 16 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-ethyl 16-oxohexadecanethioate is sourced from PubChem (CID 102082817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).