C10H13F3O4 — CID 149488981
(2,2,6-trifluoro-6-hydroxy-4-methyloxan-4-yl) 2-methylprop-2-enoate (PubChem CID 149488981) has the molecular formula C10H13F3O4 and a molecular weight of 254.20 g/mol. Its IUPAC name is (2,2,6-trifluoro-6-hydroxy-4-methyloxan-4-yl) 2-methylprop-2-enoate.
| Compound Name | (2,2,6-trifluoro-6-hydroxy-4-methyloxan-4-yl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 149488981 |
| Molecular Formula | C10H13F3O4 |
| Molecular Weight | 254.20 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | (2,2,6-trifluoro-6-hydroxy-4-methyloxan-4-yl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1(C)CC(O)(F)OC(F)(F)C1 |
| InChI | InChI=1S/C10H13F3O4/c1-6(2)7(14)16-8(3)4-9(11,12)17-10(13,15)5-8/h15H,1,4-5H2,2-3H3 |
| InChIKey | ZESORXHONSOZJO-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.20 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|