C9H11NO4 — CID 129226274
(3-isocyanato-2,3-dimethyloxiran-2-yl) 2-methylprop-2-enoate (PubChem CID 129226274) has the molecular formula C9H11NO4 and a molecular weight of 197.19 g/mol. Its IUPAC name is (3-isocyanato-2,3-dimethyloxiran-2-yl) 2-methylprop-2-enoate.
| Compound Name | (3-isocyanato-2,3-dimethyloxiran-2-yl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 129226274 |
| Molecular Formula | C9H11NO4 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | (3-isocyanato-2,3-dimethyloxiran-2-yl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1(C)OC1(C)N=C=O |
| InChI | InChI=1S/C9H11NO4/c1-6(2)7(12)13-9(4)8(3,14-9)10-5-11/h1H2,2-4H3 |
| InChIKey | FCNHAQGEDAGEKG-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 68.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|