C15H30O3 — CID 158025898
methane;(2,2,3,4,4-pentamethyloxetan-3-yl)methyl 2-methylprop-2-enoate (PubChem CID 158025898) has the molecular formula C15H30O3 and a molecular weight of 258.40 g/mol. Its IUPAC name is methane;(2,2,3,4,4-pentamethyloxetan-3-yl)methyl 2-methylprop-2-enoate.
| Compound Name | methane;(2,2,3,4,4-pentamethyloxetan-3-yl)methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 158025898 |
| Molecular Formula | C15H30O3 |
| Molecular Weight | 258.40 g/mol |
| Exact Mass | 258.22 |
| IUPAC Name | methane;(2,2,3,4,4-pentamethyloxetan-3-yl)methyl 2-methylprop-2-enoate |
| SMILES | C.C.C=C(C)C(=O)OCC1(C)C(C)(C)OC1(C)C |
| InChI | InChI=1S/C13H22O3.2CH4/c1-9(2)10(14)15-8-13(7)11(3,4)16-12(13,5)6;;/h1,8H2,2-7H3;2*1H4 |
| InChIKey | FGPGXJVZQHUMJR-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.40 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|