C11H14F4O2S2 — CID 122493344
(5,5,6,6-tetrafluoro-2-methyl-1,3-dithiepan-2-yl)methyl 2-methylprop-2-enoate (PubChem CID 122493344) has the molecular formula C11H14F4O2S2 and a molecular weight of 318.36 g/mol. Its IUPAC name is (5,5,6,6-tetrafluoro-2-methyl-1,3-dithiepan-2-yl)methyl 2-methylprop-2-enoate.
| Compound Name | (5,5,6,6-tetrafluoro-2-methyl-1,3-dithiepan-2-yl)methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 122493344 |
| Molecular Formula | C11H14F4O2S2 |
| Molecular Weight | 318.36 g/mol |
| Exact Mass | 318.04 |
| IUPAC Name | (5,5,6,6-tetrafluoro-2-methyl-1,3-dithiepan-2-yl)methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC1(C)SCC(F)(F)C(F)(F)CS1 |
| InChI | InChI=1S/C11H14F4O2S2/c1-7(2)8(16)17-4-9(3)18-5-10(12,13)11(14,15)6-19-9/h1,4-6H2,2-3H3 |
| InChIKey | FQZANZIXAYDWGL-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.36 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|