C14H16O2S2 — CID 22891773
(2,4-dimethyl-1,3-benzodithiol-2-yl)methyl 2-methylprop-2-enoate (PubChem CID 22891773) has the molecular formula C14H16O2S2 and a molecular weight of 280.41 g/mol. Its IUPAC name is (2,4-dimethyl-1,3-benzodithiol-2-yl)methyl 2-methylprop-2-enoate.
| Compound Name | (2,4-dimethyl-1,3-benzodithiol-2-yl)methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 22891773 |
| Molecular Formula | C14H16O2S2 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | (2,4-dimethyl-1,3-benzodithiol-2-yl)methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC1(C)Sc2cccc(C)c2S1 |
| InChI | InChI=1S/C14H16O2S2/c1-9(2)13(15)16-8-14(4)17-11-7-5-6-10(3)12(11)18-14/h5-7H,1,8H2,2-4H3 |
| InChIKey | UCVWNPMEWZTBBW-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|