C12H21O5P — CID 165340782
2-[(4,4,5,5-tetramethyl-1,3,2-dioxaphospholan-2-yl)oxy]ethyl 2-methylprop-2-enoate (PubChem CID 165340782) has the molecular formula C12H21O5P and a molecular weight of 276.27 g/mol. Its IUPAC name is 2-[(4,4,5,5-tetramethyl-1,3,2-dioxaphospholan-2-yl)oxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[(4,4,5,5-tetramethyl-1,3,2-dioxaphospholan-2-yl)oxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 165340782 |
| Molecular Formula | C12H21O5P |
| Molecular Weight | 276.27 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 2-[(4,4,5,5-tetramethyl-1,3,2-dioxaphospholan-2-yl)oxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOP1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C12H21O5P/c1-9(2)10(13)14-7-8-15-18-16-11(3,4)12(5,6)17-18/h1,7-8H2,2-6H3 |
| InChIKey | IFNVOPRVSHVIBD-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.27 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|