C15H26O6Si — CID 123640715
2-[ethyl-methyl-[2-(2-methylprop-2-enoyloxy)ethoxy]silyl]oxyethyl 2-methylprop-2-enoate (PubChem CID 123640715) has the molecular formula C15H26O6Si and a molecular weight of 330.45 g/mol. Its IUPAC name is 2-[ethyl-methyl-[2-(2-methylprop-2-enoyloxy)ethoxy]silyl]oxyethyl 2-methylprop-2-enoate.
| Compound Name | 2-[ethyl-methyl-[2-(2-methylprop-2-enoyloxy)ethoxy]silyl]oxyethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 123640715 |
| Molecular Formula | C15H26O6Si |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | 2-[ethyl-methyl-[2-(2-methylprop-2-enoyloxy)ethoxy]silyl]oxyethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCO[Si](C)(CC)OCCOC(=O)C(=C)C |
| InChI | InChI=1S/C15H26O6Si/c1-7-22(6,20-10-8-18-14(16)12(2)3)21-11-9-19-15(17)13(4)5/h2,4,7-11H2,1,3,5-6H3 |
| InChIKey | XTGMQOUMMFELLE-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|