C13H26O3Si2 — CID 66887567
(2,2,3,3,6-pentamethyloxadisilinan-6-yl)methyl 2-methylprop-2-enoate (PubChem CID 66887567) has the molecular formula C13H26O3Si2 and a molecular weight of 286.52 g/mol. Its IUPAC name is (2,2,3,3,6-pentamethyloxadisilinan-6-yl)methyl 2-methylprop-2-enoate.
| Compound Name | (2,2,3,3,6-pentamethyloxadisilinan-6-yl)methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 66887567 |
| Molecular Formula | C13H26O3Si2 |
| Molecular Weight | 286.52 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | (2,2,3,3,6-pentamethyloxadisilinan-6-yl)methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC1(C)CC[Si](C)(C)[Si](C)(C)O1 |
| InChI | InChI=1S/C13H26O3Si2/c1-11(2)12(14)15-10-13(3)8-9-17(4,5)18(6,7)16-13/h1,8-10H2,2-7H3 |
| InChIKey | IPLCYDINZQGUGW-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.52 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|