C15H30O3Si2 — CID 70232650
3-(2,2,3,6,6-pentamethyloxadisilinan-3-yl)propyl 2-methylprop-2-enoate (PubChem CID 70232650) has the molecular formula C15H30O3Si2 and a molecular weight of 314.57 g/mol. Its IUPAC name is 3-(2,2,3,6,6-pentamethyloxadisilinan-3-yl)propyl 2-methylprop-2-enoate.
| Compound Name | 3-(2,2,3,6,6-pentamethyloxadisilinan-3-yl)propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 70232650 |
| Molecular Formula | C15H30O3Si2 |
| Molecular Weight | 314.57 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | 3-(2,2,3,6,6-pentamethyloxadisilinan-3-yl)propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC[Si]1(C)CCC(C)(C)O[Si]1(C)C |
| InChI | InChI=1S/C15H30O3Si2/c1-13(2)14(16)17-10-8-11-20(7)12-9-15(3,4)18-19(20,5)6/h1,8-12H2,2-7H3 |
| InChIKey | CCXUAKUHYCZQBY-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.57 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|