C26H52O6Si4 — CID 67882288
bis[3-(2,2,3,6,6-pentamethyloxadisilinan-3-yl)propyl] but-2-enedioate (PubChem CID 67882288) has the molecular formula C26H52O6Si4 and a molecular weight of 573.04 g/mol. Its IUPAC name is bis[3-(2,2,3,6,6-pentamethyloxadisilinan-3-yl)propyl] but-2-enedioate.
| Compound Name | bis[3-(2,2,3,6,6-pentamethyloxadisilinan-3-yl)propyl] but-2-enedioate |
|---|---|
| PubChem CID | 67882288 |
| Molecular Formula | C26H52O6Si4 |
| Molecular Weight | 573.04 g/mol |
| Exact Mass | 572.28 |
| IUPAC Name | bis[3-(2,2,3,6,6-pentamethyloxadisilinan-3-yl)propyl] but-2-enedioate |
| SMILES | CC1(C)CC[Si](C)(CCCOC(=O)C=CC(=O)OCCC[Si]2(C)CCC(C)(C)O[Si]2(C)C)[Si](C)(C)O1 |
| InChI | InChI=1S/C26H52O6Si4/c1-25(2)15-21-35(9,33(5,6)31-25)19-11-17-29-23(27)13-14-24(28)30-18-12-20-36(10)22-16-26(3,4)32-34(36,7)8/h13-14H,11-12,15-22H2,1-10H3 |
| InChIKey | CCJFTVPDECHOEV-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.04 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|