C30H64O7Si6 — CID 70507135
3-[[3-acetyloxypropyl(dimethyl)silyl]oxy-bis(2,2,3,6,6-pentamethyloxadisilinan-3-yl)silyl]propyl 2-methylprop-2-enoate (PubChem CID 70507135) has the molecular formula C30H64O7Si6 and a molecular weight of 705.35 g/mol. Its IUPAC name is 3-[[3-acetyloxypropyl(dimethyl)silyl]oxy-bis(2,2,3,6,6-pentamethyloxadisilinan-3-yl)silyl]propyl 2-methylprop-2-enoate.
| Compound Name | 3-[[3-acetyloxypropyl(dimethyl)silyl]oxy-bis(2,2,3,6,6-pentamethyloxadisilinan-3-yl)silyl]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 70507135 |
| Molecular Formula | C30H64O7Si6 |
| Molecular Weight | 705.35 g/mol |
| Exact Mass | 704.33 |
| IUPAC Name | 3-[[3-acetyloxypropyl(dimethyl)silyl]oxy-bis(2,2,3,6,6-pentamethyloxadisilinan-3-yl)silyl]propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC[Si](O[Si](C)(C)CCCOC(C)=O)([Si]1(C)CCC(C)(C)O[Si]1(C)C)[Si]1(C)CCC(C)(C)O[Si]1(C)C |
| InChI | InChI=1S/C30H64O7Si6/c1-26(2)28(32)34-21-17-23-43(37-38(8,9)22-16-20-33-27(3)31,41(14)24-18-29(4,5)35-39(41,10)11)42(15)25-19-30(6,7)36-40(42,12)13/h1,16-25H2,2-15H3 |
| InChIKey | UZMSEPLADNCCLX-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.35 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|