C15H32O3Si3 — CID 175575645
propyl 3-(2,3,3,4,4,6,6-heptamethyloxatrisilinan-2-yl)prop-2-enoate (PubChem CID 175575645) has the molecular formula C15H32O3Si3 and a molecular weight of 344.68 g/mol. Its IUPAC name is propyl 3-(2,3,3,4,4,6,6-heptamethyloxatrisilinan-2-yl)prop-2-enoate.
| Compound Name | propyl 3-(2,3,3,4,4,6,6-heptamethyloxatrisilinan-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 175575645 |
| Molecular Formula | C15H32O3Si3 |
| Molecular Weight | 344.68 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | propyl 3-(2,3,3,4,4,6,6-heptamethyloxatrisilinan-2-yl)prop-2-enoate |
| SMILES | CCCOC(=O)C=C[Si]1(C)OC(C)(C)C[Si](C)(C)[Si]1(C)C |
| InChI | InChI=1S/C15H32O3Si3/c1-9-11-17-14(16)10-12-21(8)18-15(2,3)13-19(4,5)20(21,6)7/h10,12H,9,11,13H2,1-8H3 |
| InChIKey | KPOCYUJOMRKWBR-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.68 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|