C33H45N7O4 — CID 14950925
6-[4-[3,3-bis(3,4-dimethoxyphenyl)propylamino]piperidin-1-yl]-2-N,4-N-bis(prop-2-enyl)-1,3,5-triazine-2,4-diamine (PubChem CID 14950925) has the molecular formula C33H45N7O4 and a molecular weight of 603.77 g/mol. Its IUPAC name is 6-[4-[3,3-bis(3,4-dimethoxyphenyl)propylamino]piperidin-1-yl]-2-N,4-N-bis(prop-2-enyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[4-[3,3-bis(3,4-dimethoxyphenyl)propylamino]piperidin-1-yl]-2-N,4-N-bis(prop-2-enyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 14950925 |
| Molecular Formula | C33H45N7O4 |
| Molecular Weight | 603.77 g/mol |
| Exact Mass | 603.35 |
| IUPAC Name | 6-[4-[3,3-bis(3,4-dimethoxyphenyl)propylamino]piperidin-1-yl]-2-N,4-N-bis(prop-2-enyl)-1,3,5-triazine-2,4-diamine |
| SMILES | C=CCNc1nc(NCC=C)nc(N2CCC(NCCC(c3ccc(OC)c(OC)c3)c3ccc(OC)c(OC)c3)CC2)n1 |
| InChI | InChI=1S/C33H45N7O4/c1-7-16-35-31-37-32(36-17-8-2)39-33(38-31)40-19-14-25(15-20-40)34-18-13-26(23-9-11-27(41-3)29(21-23)43-5)24-10-12-28(42-4)30(22-24)44-6/h7-12,21-22,25-26,34H,1-2,13-20H2,3-6H3,(H2,35,36,37,38,39) |
| InChIKey | YPVSQLGAMSSSMG-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 114.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.77 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|