C30H27N3O — CID 14969682
N-methyl-N-[(E)-2-[(N-methyl-C-phenylcarbonimidoyl)amino]-1,2-diphenylethenyl]benzamide (PubChem CID 14969682) has the molecular formula C30H27N3O and a molecular weight of 445.57 g/mol. Its IUPAC name is N-methyl-N-[(E)-2-[(N-methyl-C-phenylcarbonimidoyl)amino]-1,2-diphenylethenyl]benzamide.
| Compound Name | N-methyl-N-[(E)-2-[(N-methyl-C-phenylcarbonimidoyl)amino]-1,2-diphenylethenyl]benzamide |
|---|---|
| PubChem CID | 14969682 |
| Molecular Formula | C30H27N3O |
| Molecular Weight | 445.57 g/mol |
| Exact Mass | 445.22 |
| IUPAC Name | N-methyl-N-[(E)-2-[(N-methyl-C-phenylcarbonimidoyl)amino]-1,2-diphenylethenyl]benzamide |
| SMILES | C/N=C(/N/C(=C(\c1ccccc1)N(C)C(=O)c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H27N3O/c1-31-29(25-19-11-5-12-20-25)32-27(23-15-7-3-8-16-23)28(24-17-9-4-10-18-24)33(2)30(34)26-21-13-6-14-22-26/h3-22H,1-2H3,(H,31,32)/b28-27+ |
| InChIKey | JWRLZFZKIQAZGG-BYYHNAKLSA-N |
| XLogP | 5.95 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.57 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|