C19H36O3 — CID 14975045
2-(3,3-diethoxypropyl)cyclododecan-1-one (PubChem CID 14975045) has the molecular formula C19H36O3 and a molecular weight of 312.49 g/mol. Its IUPAC name is 2-(3,3-diethoxypropyl)cyclododecan-1-one.
| Compound Name | 2-(3,3-diethoxypropyl)cyclododecan-1-one |
|---|---|
| PubChem CID | 14975045 |
| Molecular Formula | C19H36O3 |
| Molecular Weight | 312.49 g/mol |
| Exact Mass | 312.27 |
| IUPAC Name | 2-(3,3-diethoxypropyl)cyclododecan-1-one |
| SMILES | CCOC(CCC1CCCCCCCCCCC1=O)OCC |
| InChI | InChI=1S/C19H36O3/c1-3-21-19(22-4-2)16-15-17-13-11-9-7-5-6-8-10-12-14-18(17)20/h17,19H,3-16H2,1-2H3 |
| InChIKey | UCSRGPNERCAFTE-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.49 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|