About 3-chlorobuta-1,3-dien-2-yl-hydroxy-oxophosphanium
3-chlorobuta-1,3-dien-2-yl-hydroxy-oxophosphanium (PubChem CID 14978745) has the molecular formula C4H5ClO2P+
and a molecular weight of 151.51 g/mol. Its IUPAC name is 3-chlorobuta-1,3-dien-2-yl-hydroxy-oxophosphanium.
Molecular Properties
| Compound Name | 3-chlorobuta-1,3-dien-2-yl-hydroxy-oxophosphanium |
| PubChem CID | 14978745 |
| Molecular Formula | C4H5ClO2P+ |
| Molecular Weight | 151.51 g/mol |
| Exact Mass | 150.97 |
| IUPAC Name | 3-chlorobuta-1,3-dien-2-yl-hydroxy-oxophosphanium |
| SMILES | C=C(Cl)C(=C)[P+](=O)O |
| InChI | InChI=1S/C4H4ClO2P/c1-3(5)4(2)8(6)7/h1-2H2/p+1 |
| InChIKey | JQXXZETWPJIHPT-UHFFFAOYSA-O |
| XLogP | 1.99 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.51 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3-chlorobuta-1,3-dien-2-yl-hydroxy-oxophosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chlorobuta-1,3-dien-2-yl-hydroxy-oxophosphanium?
The IUPAC name of 3-chlorobuta-1,3-dien-2-yl-hydroxy-oxophosphanium (CID 14978745) is 3-chlorobuta-1,3-dien-2-yl-hydroxy-oxophosphanium.
What is the SMILES notation for 3-chlorobuta-1,3-dien-2-yl-hydroxy-oxophosphanium?
The canonical SMILES for 3-chlorobuta-1,3-dien-2-yl-hydroxy-oxophosphanium is C=C(Cl)C(=C)[P+](=O)O.
What is the InChIKey of 3-chlorobuta-1,3-dien-2-yl-hydroxy-oxophosphanium?
The InChIKey is JQXXZETWPJIHPT-UHFFFAOYSA-O. The full InChI is InChI=1S/C4H4ClO2P/c1-3(5)4(2)8(6)7/h1-2H2/p+1.
What are the key properties of 3-chlorobuta-1,3-dien-2-yl-hydroxy-oxophosphanium?
3-chlorobuta-1,3-dien-2-yl-hydroxy-oxophosphanium has a molecular weight of 151.51 g/mol, XLogP of 1.99, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chlorobuta-1,3-dien-2-yl-hydroxy-oxophosphanium is sourced from PubChem (CID 14978745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).