About N-[[(3-benzyl-2,6-dioxo-1-propylpyrimidin-4-yl)amino]carbamothioyl]acetamide
N-[[(3-benzyl-2,6-dioxo-1-propylpyrimidin-4-yl)amino]carbamothioyl]acetamide (PubChem CID 14986831) has the molecular formula C17H21N5O3S
and a molecular weight of 375.45 g/mol. Its IUPAC name is N-[[(3-benzyl-2,6-dioxo-1-propylpyrimidin-4-yl)amino]carbamothioyl]acetamide.
Molecular Properties
| Compound Name | N-[[(3-benzyl-2,6-dioxo-1-propylpyrimidin-4-yl)amino]carbamothioyl]acetamide |
| PubChem CID | 14986831 |
| Molecular Formula | C17H21N5O3S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | N-[[(3-benzyl-2,6-dioxo-1-propylpyrimidin-4-yl)amino]carbamothioyl]acetamide |
| SMILES | CCCn1c(=O)cc(NNC(=S)NC(C)=O)n(Cc2ccccc2)c1=O |
| InChI | InChI=1S/C17H21N5O3S/c1-3-9-21-15(24)10-14(19-20-16(26)18-12(2)23)22(17(21)25)11-13-7-5-4-6-8-13/h4-8,10,19H,3,9,11H2,1-2H3,(H2,18,20,23,26) |
| InChIKey | DYZAYOQKSOVOMI-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 97.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N-[[(3-benzyl-2,6-dioxo-1-propylpyrimidin-4-yl)amino]carbamothioyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[(3-benzyl-2,6-dioxo-1-propylpyrimidin-4-yl)amino]carbamothioyl]acetamide?
The IUPAC name of N-[[(3-benzyl-2,6-dioxo-1-propylpyrimidin-4-yl)amino]carbamothioyl]acetamide (CID 14986831) is N-[[(3-benzyl-2,6-dioxo-1-propylpyrimidin-4-yl)amino]carbamothioyl]acetamide.
What is the SMILES notation for N-[[(3-benzyl-2,6-dioxo-1-propylpyrimidin-4-yl)amino]carbamothioyl]acetamide?
The canonical SMILES for N-[[(3-benzyl-2,6-dioxo-1-propylpyrimidin-4-yl)amino]carbamothioyl]acetamide is CCCn1c(=O)cc(NNC(=S)NC(C)=O)n(Cc2ccccc2)c1=O.
What is the InChIKey of N-[[(3-benzyl-2,6-dioxo-1-propylpyrimidin-4-yl)amino]carbamothioyl]acetamide?
The InChIKey is DYZAYOQKSOVOMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21N5O3S/c1-3-9-21-15(24)10-14(19-20-16(26)18-12(2)23)22(17(21)25)11-13-7-5-4-6-8-13/h4-8,10,19H,3,9,11H2,1-2H3,(H2,18,20,23,26).
What are the key properties of N-[[(3-benzyl-2,6-dioxo-1-propylpyrimidin-4-yl)amino]carbamothioyl]acetamide?
N-[[(3-benzyl-2,6-dioxo-1-propylpyrimidin-4-yl)amino]carbamothioyl]acetamide has a molecular weight of 375.45 g/mol, XLogP of 0.81, 6 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[(3-benzyl-2,6-dioxo-1-propylpyrimidin-4-yl)amino]carbamothioyl]acetamide is sourced from PubChem (CID 14986831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).