C14H18N2O2S2 — CID 1498720
N-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)adamantane-1-carboxamide (PubChem CID 1498720) has the molecular formula C14H18N2O2S2 and a molecular weight of 310.44 g/mol. Its IUPAC name is N-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)adamantane-1-carboxamide.
| Compound Name | N-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)adamantane-1-carboxamide |
|---|---|
| PubChem CID | 1498720 |
| Molecular Formula | C14H18N2O2S2 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | N-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)adamantane-1-carboxamide |
| SMILES | O=C1CSC(=S)N1NC(=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C14H18N2O2S2/c17-11-7-20-13(19)16(11)15-12(18)14-4-8-1-9(5-14)3-10(2-8)6-14/h8-10H,1-7H2,(H,15,18) |
| InChIKey | ZIFOQLMUVLPGEM-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|