C17H23N — CID 14992018
5-methyl-3-(2,6,6-trimethylcyclohex-2-en-1-yl)cyclohexa-1,5-diene-1-carbonitrile (PubChem CID 14992018) has the molecular formula C17H23N and a molecular weight of 241.38 g/mol. Its IUPAC name is 5-methyl-3-(2,6,6-trimethylcyclohex-2-en-1-yl)cyclohexa-1,5-diene-1-carbonitrile.
| Compound Name | 5-methyl-3-(2,6,6-trimethylcyclohex-2-en-1-yl)cyclohexa-1,5-diene-1-carbonitrile |
|---|---|
| PubChem CID | 14992018 |
| Molecular Formula | C17H23N |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.18 |
| IUPAC Name | 5-methyl-3-(2,6,6-trimethylcyclohex-2-en-1-yl)cyclohexa-1,5-diene-1-carbonitrile |
| SMILES | CC1=CC(C#N)=CC(C2C(C)=CCCC2(C)C)C1 |
| InChI | InChI=1S/C17H23N/c1-12-8-14(11-18)10-15(9-12)16-13(2)6-5-7-17(16,3)4/h6,8,10,15-16H,5,7,9H2,1-4H3 |
| InChIKey | HYFUCMPVEAYPEG-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|