About 4-(3,4-dichlorophenyl)-1-ethyl-N-(4-nitrophenyl)piperazine-2-carboxamide
4-(3,4-dichlorophenyl)-1-ethyl-N-(4-nitrophenyl)piperazine-2-carboxamide (PubChem CID 14998843) has the molecular formula C19H20Cl2N4O3
and a molecular weight of 423.30 g/mol. Its IUPAC name is 4-(3,4-dichlorophenyl)-1-ethyl-N-(4-nitrophenyl)piperazine-2-carboxamide.
Molecular Properties
| Compound Name | 4-(3,4-dichlorophenyl)-1-ethyl-N-(4-nitrophenyl)piperazine-2-carboxamide |
| PubChem CID | 14998843 |
| Molecular Formula | C19H20Cl2N4O3 |
| Molecular Weight | 423.30 g/mol |
| Exact Mass | 422.09 |
| IUPAC Name | 4-(3,4-dichlorophenyl)-1-ethyl-N-(4-nitrophenyl)piperazine-2-carboxamide |
| SMILES | CCN1CCN(c2ccc(Cl)c(Cl)c2)CC1C(=O)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H20Cl2N4O3/c1-2-23-9-10-24(15-7-8-16(20)17(21)11-15)12-18(23)19(26)22-13-3-5-14(6-4-13)25(27)28/h3-8,11,18H,2,9-10,12H2,1H3,(H,22,26) |
| InChIKey | KPLFGZRHDRDKSS-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 78.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 423.30 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(3,4-dichlorophenyl)-1-ethyl-N-(4-nitrophenyl)piperazine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,4-dichlorophenyl)-1-ethyl-N-(4-nitrophenyl)piperazine-2-carboxamide?
The IUPAC name of 4-(3,4-dichlorophenyl)-1-ethyl-N-(4-nitrophenyl)piperazine-2-carboxamide (CID 14998843) is 4-(3,4-dichlorophenyl)-1-ethyl-N-(4-nitrophenyl)piperazine-2-carboxamide.
What is the SMILES notation for 4-(3,4-dichlorophenyl)-1-ethyl-N-(4-nitrophenyl)piperazine-2-carboxamide?
The canonical SMILES for 4-(3,4-dichlorophenyl)-1-ethyl-N-(4-nitrophenyl)piperazine-2-carboxamide is CCN1CCN(c2ccc(Cl)c(Cl)c2)CC1C(=O)Nc1ccc([N+](=O)[O-])cc1.
What is the InChIKey of 4-(3,4-dichlorophenyl)-1-ethyl-N-(4-nitrophenyl)piperazine-2-carboxamide?
The InChIKey is KPLFGZRHDRDKSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20Cl2N4O3/c1-2-23-9-10-24(15-7-8-16(20)17(21)11-15)12-18(23)19(26)22-13-3-5-14(6-4-13)25(27)28/h3-8,11,18H,2,9-10,12H2,1H3,(H,22,26).
What are the key properties of 4-(3,4-dichlorophenyl)-1-ethyl-N-(4-nitrophenyl)piperazine-2-carboxamide?
4-(3,4-dichlorophenyl)-1-ethyl-N-(4-nitrophenyl)piperazine-2-carboxamide has a molecular weight of 423.30 g/mol, XLogP of 4.05, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,4-dichlorophenyl)-1-ethyl-N-(4-nitrophenyl)piperazine-2-carboxamide is sourced from PubChem (CID 14998843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).