C28H44FNO2 — CID 150008970
4-fluoro-1-[11-methyl-10,10-di(propan-2-yl)dodecyl]indole-5-carboxylic acid (PubChem CID 150008970) has the molecular formula C28H44FNO2 and a molecular weight of 445.66 g/mol. Its IUPAC name is 4-fluoro-1-[11-methyl-10,10-di(propan-2-yl)dodecyl]indole-5-carboxylic acid.
| Compound Name | 4-fluoro-1-[11-methyl-10,10-di(propan-2-yl)dodecyl]indole-5-carboxylic acid |
|---|---|
| PubChem CID | 150008970 |
| Molecular Formula | C28H44FNO2 |
| Molecular Weight | 445.66 g/mol |
| Exact Mass | 445.34 |
| IUPAC Name | 4-fluoro-1-[11-methyl-10,10-di(propan-2-yl)dodecyl]indole-5-carboxylic acid |
| SMILES | CC(C)C(CCCCCCCCCn1ccc2c(F)c(C(=O)O)ccc21)(C(C)C)C(C)C |
| InChI | InChI=1S/C28H44FNO2/c1-20(2)28(21(3)4,22(5)6)17-12-10-8-7-9-11-13-18-30-19-16-23-25(30)15-14-24(26(23)29)27(31)32/h14-16,19-22H,7-13,17-18H2,1-6H3,(H,31,32) |
| InChIKey | DCWWTFZIVFVDRF-UHFFFAOYSA-N |
| XLogP | 8.55 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.66 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|