C29H37FN4O3 — CID 150022197
tert-butyl N-[6-[[4-(6-fluoro-9-oxo-3,10-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraen-2-yl)phenyl]methylamino]hexyl]carbamate (PubChem CID 150022197) has the molecular formula C29H37FN4O3 and a molecular weight of 508.64 g/mol. Its IUPAC name is tert-butyl N-[6-[[4-(6-fluoro-9-oxo-3,10-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraen-2-yl)phenyl]methylamino]hexyl]carbamate.
| Compound Name | tert-butyl N-[6-[[4-(6-fluoro-9-oxo-3,10-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraen-2-yl)phenyl]methylamino]hexyl]carbamate |
|---|---|
| PubChem CID | 150022197 |
| Molecular Formula | C29H37FN4O3 |
| Molecular Weight | 508.64 g/mol |
| Exact Mass | 508.28 |
| IUPAC Name | tert-butyl N-[6-[[4-(6-fluoro-9-oxo-3,10-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraen-2-yl)phenyl]methylamino]hexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCCCNCc1ccc(-c2[nH]c3cc(F)cc4c3c2CCNC4=O)cc1 |
| InChI | InChI=1S/C29H37FN4O3/c1-29(2,3)37-28(36)33-14-7-5-4-6-13-31-18-19-8-10-20(11-9-19)26-22-12-15-32-27(35)23-16-21(30)17-24(34-26)25(22)23/h8-11,16-17,31,34H,4-7,12-15,18H2,1-3H3,(H,32,35)(H,33,36) |
| InChIKey | DFMDWSMWBDUMAX-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 95.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.64 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|