C14H6F9NO2 — CID 150046325
3-[2,3,6-trifluoro-5-methoxy-4-(trifluoromethyl)phenyl]-4-(trifluoromethyl)-1H-pyridin-2-one (PubChem CID 150046325) has the molecular formula C14H6F9NO2 and a molecular weight of 391.19 g/mol. Its IUPAC name is 3-[2,3,6-trifluoro-5-methoxy-4-(trifluoromethyl)phenyl]-4-(trifluoromethyl)-1H-pyridin-2-one.
| Compound Name | 3-[2,3,6-trifluoro-5-methoxy-4-(trifluoromethyl)phenyl]-4-(trifluoromethyl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 150046325 |
| Molecular Formula | C14H6F9NO2 |
| Molecular Weight | 391.19 g/mol |
| Exact Mass | 391.03 |
| IUPAC Name | 3-[2,3,6-trifluoro-5-methoxy-4-(trifluoromethyl)phenyl]-4-(trifluoromethyl)-1H-pyridin-2-one |
| SMILES | COc1c(F)c(-c2c(C(F)(F)F)cc[nH]c2=O)c(F)c(F)c1C(F)(F)F |
| InChI | InChI=1S/C14H6F9NO2/c1-26-11-7(14(21,22)23)10(17)8(15)6(9(11)16)5-4(13(18,19)20)2-3-24-12(5)25/h2-3H,1H3,(H,24,25) |
| InChIKey | DKITWWGPZNNATK-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.19 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|