C22H27N5O5 — CID 15005639
ethyl 2-[4-[4-[(2-oxo-1,3-dihydroimidazo[4,5-b]quinolin-7-yl)oxy]butanoyl]piperazin-1-yl]acetate (PubChem CID 15005639) has the molecular formula C22H27N5O5 and a molecular weight of 441.49 g/mol. Its IUPAC name is ethyl 2-[4-[4-[(2-oxo-1,3-dihydroimidazo[4,5-b]quinolin-7-yl)oxy]butanoyl]piperazin-1-yl]acetate.
| Compound Name | ethyl 2-[4-[4-[(2-oxo-1,3-dihydroimidazo[4,5-b]quinolin-7-yl)oxy]butanoyl]piperazin-1-yl]acetate |
|---|---|
| PubChem CID | 15005639 |
| Molecular Formula | C22H27N5O5 |
| Molecular Weight | 441.49 g/mol |
| Exact Mass | 441.20 |
| IUPAC Name | ethyl 2-[4-[4-[(2-oxo-1,3-dihydroimidazo[4,5-b]quinolin-7-yl)oxy]butanoyl]piperazin-1-yl]acetate |
| SMILES | CCOC(=O)CN1CCN(C(=O)CCCOc2ccc3nc4[nH]c(=O)[nH]c4cc3c2)CC1 |
| InChI | InChI=1S/C22H27N5O5/c1-2-31-20(29)14-26-7-9-27(10-8-26)19(28)4-3-11-32-16-5-6-17-15(12-16)13-18-21(23-17)25-22(30)24-18/h5-6,12-13H,2-4,7-11,14H2,1H3,(H2,23,24,25,30) |
| InChIKey | WPDWXTWQPSXKDE-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 120.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.49 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|