C21H25N7O2 — CID 14281027
7-[4-(1-cyclohexyltetrazol-5-yl)butoxy]-1,3-dihydroimidazo[4,5-b]quinolin-2-one (PubChem CID 14281027) has the molecular formula C21H25N7O2 and a molecular weight of 407.48 g/mol. Its IUPAC name is 7-[4-(1-cyclohexyltetrazol-5-yl)butoxy]-1,3-dihydroimidazo[4,5-b]quinolin-2-one.
| Compound Name | 7-[4-(1-cyclohexyltetrazol-5-yl)butoxy]-1,3-dihydroimidazo[4,5-b]quinolin-2-one |
|---|---|
| PubChem CID | 14281027 |
| Molecular Formula | C21H25N7O2 |
| Molecular Weight | 407.48 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | 7-[4-(1-cyclohexyltetrazol-5-yl)butoxy]-1,3-dihydroimidazo[4,5-b]quinolin-2-one |
| SMILES | O=c1[nH]c2cc3cc(OCCCCc4nnnn4C4CCCCC4)ccc3nc2[nH]1 |
| InChI | InChI=1S/C21H25N7O2/c29-21-23-18-13-14-12-16(9-10-17(14)22-20(18)24-21)30-11-5-4-8-19-25-26-27-28(19)15-6-2-1-3-7-15/h9-10,12-13,15H,1-8,11H2,(H2,22,23,24,29) |
| InChIKey | JAODEWCDRHAJPF-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 114.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.48 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|