C20H30N5O6P — CID 56963281
6-[4-(1-cyclohexyltetrazol-5-yl)butoxy]-3,4-dihydro-1H-quinolin-2-one;phosphoric acid (PubChem CID 56963281) has the molecular formula C20H30N5O6P and a molecular weight of 467.46 g/mol. Its IUPAC name is 6-[4-(1-cyclohexyltetrazol-5-yl)butoxy]-3,4-dihydro-1H-quinolin-2-one;phosphoric acid.
| Compound Name | 6-[4-(1-cyclohexyltetrazol-5-yl)butoxy]-3,4-dihydro-1H-quinolin-2-one;phosphoric acid |
|---|---|
| PubChem CID | 56963281 |
| Molecular Formula | C20H30N5O6P |
| Molecular Weight | 467.46 g/mol |
| Exact Mass | 467.19 |
| IUPAC Name | 6-[4-(1-cyclohexyltetrazol-5-yl)butoxy]-3,4-dihydro-1H-quinolin-2-one;phosphoric acid |
| SMILES | O=C1CCc2cc(OCCCCc3nnnn3C3CCCCC3)ccc2N1.O=P(O)(O)O |
| InChI | InChI=1S/C20H27N5O2.H3O4P/c26-20-12-9-15-14-17(10-11-18(15)21-20)27-13-5-4-8-19-22-23-24-25(19)16-6-2-1-3-7-16;1-5(2,3)4/h10-11,14,16H,1-9,12-13H2,(H,21,26);(H3,1,2,3,4) |
| InChIKey | UZKKFDKJWGRMLR-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 159.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.46 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|