C40H54N10O4 — CID 67172975
6-[4-(1-cyclohexyltetrazol-5-yl)butoxy]-3,4-dihydro-1H-quinolin-2-one (PubChem CID 67172975) has the molecular formula C40H54N10O4 and a molecular weight of 738.94 g/mol. Its IUPAC name is 6-[4-(1-cyclohexyltetrazol-5-yl)butoxy]-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-[4-(1-cyclohexyltetrazol-5-yl)butoxy]-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 67172975 |
| Molecular Formula | C40H54N10O4 |
| Molecular Weight | 738.94 g/mol |
| Exact Mass | 738.43 |
| IUPAC Name | 6-[4-(1-cyclohexyltetrazol-5-yl)butoxy]-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C1CCc2cc(OCCCCc3nnnn3C3CCCCC3)ccc2N1.O=C1CCc2cc(OCCCCc3nnnn3C3CCCCC3)ccc2N1 |
| InChI | InChI=1S/2C20H27N5O2/c2*26-20-12-9-15-14-17(10-11-18(15)21-20)27-13-5-4-8-19-22-23-24-25(19)16-6-2-1-3-7-16/h2*10-11,14,16H,1-9,12-13H2,(H,21,26) |
| InChIKey | JKHDONDGOCAVIQ-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 163.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.94 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|